About 2-pyrrolidin-1-ylethyl hydrogen sulfite
2-pyrrolidin-1-ylethyl hydrogen sulfite (PubChem CID 174831724) has the molecular formula C6H13NO3S
and a molecular weight of 179.24 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl hydrogen sulfite.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-ylethyl hydrogen sulfite |
| PubChem CID | 174831724 |
| Molecular Formula | C6H13NO3S |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 2-pyrrolidin-1-ylethyl hydrogen sulfite |
| SMILES | O=S(O)OCCN1CCCC1 |
| InChI | InChI=1S/C6H13NO3S/c8-11(9)10-6-5-7-3-1-2-4-7/h1-6H2,(H,8,9) |
| InChIKey | PZDYYXRKWKZWJM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-1-ylethyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-ylethyl hydrogen sulfite?
The IUPAC name of 2-pyrrolidin-1-ylethyl hydrogen sulfite (CID 174831724) is 2-pyrrolidin-1-ylethyl hydrogen sulfite.
What is the SMILES notation for 2-pyrrolidin-1-ylethyl hydrogen sulfite?
The canonical SMILES for 2-pyrrolidin-1-ylethyl hydrogen sulfite is O=S(O)OCCN1CCCC1.
What is the InChIKey of 2-pyrrolidin-1-ylethyl hydrogen sulfite?
The InChIKey is PZDYYXRKWKZWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3S/c8-11(9)10-6-5-7-3-1-2-4-7/h1-6H2,(H,8,9).
What are the key properties of 2-pyrrolidin-1-ylethyl hydrogen sulfite?
2-pyrrolidin-1-ylethyl hydrogen sulfite has a molecular weight of 179.24 g/mol, XLogP of 0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylethyl hydrogen sulfite is sourced from PubChem (CID 174831724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).