2-pyrrolidin-1-ylethyl hydrogen sulfite

C6H13NO3S — CID 174831724

IUPAC2-pyrrolidin-1-ylethyl hydrogen sulfite
SMILESO=S(O)OCCN1CCCC1
InChIInChI=1S/C6H13NO3S/c8-11(9)10-6-5-7-3-1-2-4-7/h1-6H2,(H,8,9)
InChIKeyPZDYYXRKWKZWJM-UHFFFAOYSA-N
MW179.24 g/mol
LogP0.24
Rot. Bonds4

About 2-pyrrolidin-1-ylethyl hydrogen sulfite

2-pyrrolidin-1-ylethyl hydrogen sulfite (PubChem CID 174831724) has the molecular formula C6H13NO3S and a molecular weight of 179.24 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl hydrogen sulfite.

Molecular Properties

Compound Name2-pyrrolidin-1-ylethyl hydrogen sulfite
PubChem CID174831724
Molecular FormulaC6H13NO3S
Molecular Weight179.24 g/mol
Exact Mass179.06
IUPAC Name2-pyrrolidin-1-ylethyl hydrogen sulfite
SMILESO=S(O)OCCN1CCCC1
InChIInChI=1S/C6H13NO3S/c8-11(9)10-6-5-7-3-1-2-4-7/h1-6H2,(H,8,9)
InChIKeyPZDYYXRKWKZWJM-UHFFFAOYSA-N
XLogP0.24
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.24
LogP ≤ 50.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 2-pyrrolidin-1-ylethyl hydrogen sulfite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pyrrolidin-1-ylethyl hydrogen sulfite?
The IUPAC name of 2-pyrrolidin-1-ylethyl hydrogen sulfite (CID 174831724) is 2-pyrrolidin-1-ylethyl hydrogen sulfite.
What is the SMILES notation for 2-pyrrolidin-1-ylethyl hydrogen sulfite?
The canonical SMILES for 2-pyrrolidin-1-ylethyl hydrogen sulfite is O=S(O)OCCN1CCCC1.
What is the InChIKey of 2-pyrrolidin-1-ylethyl hydrogen sulfite?
The InChIKey is PZDYYXRKWKZWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3S/c8-11(9)10-6-5-7-3-1-2-4-7/h1-6H2,(H,8,9).
What are the key properties of 2-pyrrolidin-1-ylethyl hydrogen sulfite?
2-pyrrolidin-1-ylethyl hydrogen sulfite has a molecular weight of 179.24 g/mol, XLogP of 0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylethyl hydrogen sulfite is sourced from PubChem (CID 174831724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).