About but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine
but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine (PubChem CID 71419746) has the molecular formula C11H19NO5
and a molecular weight of 245.27 g/mol. Its IUPAC name is but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine.
Molecular Properties
| Compound Name | but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine |
| PubChem CID | 71419746 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine |
| SMILES | COCCN1CCCC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C7H15NO.C4H4O4/c1-9-7-6-8-4-2-3-5-8;5-3(6)1-2-4(7)8/h2-7H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | MWKXOWHHUKTELZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine?
The IUPAC name of but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine (CID 71419746) is but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine.
What is the SMILES notation for but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine?
The canonical SMILES for but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine is COCCN1CCCC1.O=C(O)C=CC(=O)O.
What is the InChIKey of but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine?
The InChIKey is MWKXOWHHUKTELZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C4H4O4/c1-9-7-6-8-4-2-3-5-8;5-3(6)1-2-4(7)8/h2-7H2,1H3;1-2H,(H,5,6)(H,7,8).
What are the key properties of but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine?
but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine has a molecular weight of 245.27 g/mol, XLogP of 0.44, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;1-(2-methoxyethyl)pyrrolidine is sourced from PubChem (CID 71419746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).