C13H21NO4 — CID 90453515
4-O-[2-(azepan-1-yl)ethyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 90453515) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 4-O-[2-(azepan-1-yl)ethyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-(azepan-1-yl)ethyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 90453515 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-O-[2-(azepan-1-yl)ethyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCCN1CCCCCC1 |
| InChI | InChI=1S/C13H21NO4/c1-17-12(15)6-7-13(16)18-11-10-14-8-4-2-3-5-9-14/h6-7H,2-5,8-11H2,1H3/b7-6+ |
| InChIKey | JBOPJGQDMOADKJ-VOTSOKGWSA-N |
| XLogP | 1.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|