C13H22ClNO5 — CID 90411129
4-O-[2-(2,2-dimethylmorpholin-4-yl)ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride (PubChem CID 90411129) has the molecular formula C13H22ClNO5 and a molecular weight of 307.77 g/mol. Its IUPAC name is 4-O-[2-(2,2-dimethylmorpholin-4-yl)ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride.
| Compound Name | 4-O-[2-(2,2-dimethylmorpholin-4-yl)ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride |
|---|---|
| PubChem CID | 90411129 |
| Molecular Formula | C13H22ClNO5 |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-O-[2-(2,2-dimethylmorpholin-4-yl)ethyl] 1-O-methyl (E)-but-2-enedioate;hydrochloride |
| SMILES | COC(=O)/C=C/C(=O)OCCN1CCOC(C)(C)C1.Cl |
| InChI | InChI=1S/C13H21NO5.ClH/c1-13(2)10-14(7-9-19-13)6-8-18-12(16)5-4-11(15)17-3;/h4-5H,6-10H2,1-3H3;1H/b5-4+; |
| InChIKey | VSBKBBKAEUDYPC-FXRZFVDSSA-N |
| XLogP | 0.79 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|