C10H19NO3 — CID 43593005
4-(2,2-dimethylmorpholin-4-yl)butanoic acid (PubChem CID 43593005) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-(2,2-dimethylmorpholin-4-yl)butanoic acid.
| Compound Name | 4-(2,2-dimethylmorpholin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 43593005 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 4-(2,2-dimethylmorpholin-4-yl)butanoic acid |
| SMILES | CC1(C)CN(CCCC(=O)O)CCO1 |
| InChI | InChI=1S/C10H19NO3/c1-10(2)8-11(6-7-14-10)5-3-4-9(12)13/h3-8H2,1-2H3,(H,12,13) |
| InChIKey | MOWXVHUBFNYYIL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |