C10H22N2O — CID 43592480
4-(2,2-dimethylmorpholin-4-yl)butan-1-amine (PubChem CID 43592480) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-(2,2-dimethylmorpholin-4-yl)butan-1-amine.
| Compound Name | 4-(2,2-dimethylmorpholin-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 43592480 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 4-(2,2-dimethylmorpholin-4-yl)butan-1-amine |
| SMILES | CC1(C)CN(CCCCN)CCO1 |
| InChI | InChI=1S/C10H22N2O/c1-10(2)9-12(7-8-13-10)6-4-3-5-11/h3-9,11H2,1-2H3 |
| InChIKey | YDNIYAWZWKLYAH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|