C11H25NO2 — CID 162683965
3-(2,2-dimethylmorpholin-4-yl)propan-1-ol;ethane (PubChem CID 162683965) has the molecular formula C11H25NO2 and a molecular weight of 203.33 g/mol. Its IUPAC name is 3-(2,2-dimethylmorpholin-4-yl)propan-1-ol;ethane.
| Compound Name | 3-(2,2-dimethylmorpholin-4-yl)propan-1-ol;ethane |
|---|---|
| PubChem CID | 162683965 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | 3-(2,2-dimethylmorpholin-4-yl)propan-1-ol;ethane |
| SMILES | CC.CC1(C)CN(CCCO)CCO1 |
| InChI | InChI=1S/C9H19NO2.C2H6/c1-9(2)8-10(4-3-6-11)5-7-12-9;1-2/h11H,3-8H2,1-2H3;1-2H3 |
| InChIKey | UMECHHARPYCTQG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |