C12H25NO2 — CID 102745117
4-(2,2,6,6-tetramethylmorpholin-4-yl)butan-1-ol (PubChem CID 102745117) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 4-(2,2,6,6-tetramethylmorpholin-4-yl)butan-1-ol.
| Compound Name | 4-(2,2,6,6-tetramethylmorpholin-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 102745117 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 4-(2,2,6,6-tetramethylmorpholin-4-yl)butan-1-ol |
| SMILES | CC1(C)CN(CCCCO)CC(C)(C)O1 |
| InChI | InChI=1S/C12H25NO2/c1-11(2)9-13(7-5-6-8-14)10-12(3,4)15-11/h14H,5-10H2,1-4H3 |
| InChIKey | SWWIRNVBJOLXBI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|