C13H26ClNO — CID 102745265
4-(5-chloropentyl)-2,2,6,6-tetramethylmorpholine (PubChem CID 102745265) has the molecular formula C13H26ClNO and a molecular weight of 247.81 g/mol. Its IUPAC name is 4-(5-chloropentyl)-2,2,6,6-tetramethylmorpholine.
| Compound Name | 4-(5-chloropentyl)-2,2,6,6-tetramethylmorpholine |
|---|---|
| PubChem CID | 102745265 |
| Molecular Formula | C13H26ClNO |
| Molecular Weight | 247.81 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 4-(5-chloropentyl)-2,2,6,6-tetramethylmorpholine |
| SMILES | CC1(C)CN(CCCCCCl)CC(C)(C)O1 |
| InChI | InChI=1S/C13H26ClNO/c1-12(2)10-15(9-7-5-6-8-14)11-13(3,4)16-12/h5-11H2,1-4H3 |
| InChIKey | BTDVLOXKFQPCIC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|