C13H27NO2 — CID 102745123
2-methyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)butan-2-ol (PubChem CID 102745123) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-methyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)butan-2-ol.
| Compound Name | 2-methyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)butan-2-ol |
|---|---|
| PubChem CID | 102745123 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-methyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)butan-2-ol |
| SMILES | CC(C)(O)CCN1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C13H27NO2/c1-11(2,15)7-8-14-9-12(3,4)16-13(5,6)10-14/h15H,7-10H2,1-6H3 |
| InChIKey | YERFSVKRCUULAC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |