C14H29N3O — CID 102744138
2,2-dimethyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)butanimidamide (PubChem CID 102744138) has the molecular formula C14H29N3O and a molecular weight of 255.41 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)butanimidamide.
| Compound Name | 2,2-dimethyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)butanimidamide |
|---|---|
| PubChem CID | 102744138 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | 2,2-dimethyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C14H29N3O/c1-12(2,11(15)16)7-8-17-9-13(3,4)18-14(5,6)10-17/h7-10H2,1-6H3,(H3,15,16) |
| InChIKey | QVCFRCLPJYRGAJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|