C11H23N3O — CID 102744123
3-(2,2,6,6-tetramethylmorpholin-4-yl)propanimidamide (PubChem CID 102744123) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-(2,2,6,6-tetramethylmorpholin-4-yl)propanimidamide.
| Compound Name | 3-(2,2,6,6-tetramethylmorpholin-4-yl)propanimidamide |
|---|---|
| PubChem CID | 102744123 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-(2,2,6,6-tetramethylmorpholin-4-yl)propanimidamide |
| SMILES | [H]/N=C(\N)CCN1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C11H23N3O/c1-10(2)7-14(6-5-9(12)13)8-11(3,4)15-10/h5-8H2,1-4H3,(H3,12,13) |
| InChIKey | GZHMCOVZLCCWFD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|