C15H29NO2 — CID 165459746
2-methyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)hexan-3-one (PubChem CID 165459746) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 2-methyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)hexan-3-one.
| Compound Name | 2-methyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)hexan-3-one |
|---|---|
| PubChem CID | 165459746 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 2-methyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)hexan-3-one |
| SMILES | CC(C)C(=O)CCCN1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C15H29NO2/c1-12(2)13(17)8-7-9-16-10-14(3,4)18-15(5,6)11-16/h12H,7-11H2,1-6H3 |
| InChIKey | CLPMWKROYQFSHT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |