methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate

C13H25NO3 — CID 102744546

IUPACmethyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate
SMILESCOC(=O)C(C)CN1CC(C)(C)OC(C)(C)C1
InChIInChI=1S/C13H25NO3/c1-10(11(15)16-6)7-14-8-12(2,3)17-13(4,5)9-14/h10H,7-9H2,1-6H3
InChIKeyYWUNQRFEKYGYHD-UHFFFAOYSA-N
MW243.35 g/mol
LogP1.68
Rot. Bonds3

About methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate

methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate (PubChem CID 102744546) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate
PubChem CID102744546
Molecular FormulaC13H25NO3
Molecular Weight243.35 g/mol
Exact Mass243.18
IUPAC Namemethyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate
SMILESCOC(=O)C(C)CN1CC(C)(C)OC(C)(C)C1
InChIInChI=1S/C13H25NO3/c1-10(11(15)16-6)7-14-8-12(2,3)17-13(4,5)9-14/h10H,7-9H2,1-6H3
InChIKeyYWUNQRFEKYGYHD-UHFFFAOYSA-N
XLogP1.68
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.35
LogP ≤ 51.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate?
The IUPAC name of methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate (CID 102744546) is methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate.
What is the SMILES notation for methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate?
The canonical SMILES for methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate is COC(=O)C(C)CN1CC(C)(C)OC(C)(C)C1.
What is the InChIKey of methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate?
The InChIKey is YWUNQRFEKYGYHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-10(11(15)16-6)7-14-8-12(2,3)17-13(4,5)9-14/h10H,7-9H2,1-6H3.
What are the key properties of methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate?
methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate has a molecular weight of 243.35 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanoate is sourced from PubChem (CID 102744546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).