C12H25N3O2 — CID 102746297
2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanehydrazide (PubChem CID 102746297) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanehydrazide.
| Compound Name | 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanehydrazide |
|---|---|
| PubChem CID | 102746297 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 2-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propanehydrazide |
| SMILES | CC(CN1CC(C)(C)OC(C)(C)C1)C(=O)NN |
| InChI | InChI=1S/C12H25N3O2/c1-9(10(16)14-13)6-15-7-11(2,3)17-12(4,5)8-15/h9H,6-8,13H2,1-5H3,(H,14,16) |
| InChIKey | SHJCZNMSPVCBKE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|