C10H21N3O2 — CID 104961276
3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropanehydrazide (PubChem CID 104961276) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropanehydrazide.
| Compound Name | 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 104961276 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropanehydrazide |
| SMILES | CC(CN1C[C@@H](C)O[C@@H](C)C1)C(=O)NN |
| InChI | InChI=1S/C10H21N3O2/c1-7(10(14)12-11)4-13-5-8(2)15-9(3)6-13/h7-9H,4-6,11H2,1-3H3,(H,12,14)/t7?,8-,9+ |
| InChIKey | DOXDICKGIDCSNM-CBLAIPOGSA-N |
| XLogP | -0.28 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|