About 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide
3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide (PubChem CID 130632039) has the molecular formula C8H15F2N3O
and a molecular weight of 207.22 g/mol. Its IUPAC name is 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide.
Molecular Properties
| Compound Name | 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide |
| PubChem CID | 130632039 |
| Molecular Formula | C8H15F2N3O |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide |
| SMILES | CC(CN1CCC(F)(F)C1)C(=O)NN |
| InChI | InChI=1S/C8H15F2N3O/c1-6(7(14)12-11)4-13-3-2-8(9,10)5-13/h6H,2-5,11H2,1H3,(H,12,14) |
| InChIKey | LMCLSVXAEAFQTF-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide?
The IUPAC name of 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide (CID 130632039) is 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide.
What is the SMILES notation for 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide?
The canonical SMILES for 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide is CC(CN1CCC(F)(F)C1)C(=O)NN.
What is the InChIKey of 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide?
The InChIKey is LMCLSVXAEAFQTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2N3O/c1-6(7(14)12-11)4-13-3-2-8(9,10)5-13/h6H,2-5,11H2,1H3,(H,12,14).
What are the key properties of 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide?
3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide has a molecular weight of 207.22 g/mol, XLogP of -0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluoropyrrolidin-1-yl)-2-methylpropanehydrazide is sourced from PubChem (CID 130632039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).