C9H19N3O2 — CID 102745077
2,2,6,6-tetramethylmorpholine-4-carbohydrazide (PubChem CID 102745077) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2,2,6,6-tetramethylmorpholine-4-carbohydrazide.
| Compound Name | 2,2,6,6-tetramethylmorpholine-4-carbohydrazide |
|---|---|
| PubChem CID | 102745077 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2,2,6,6-tetramethylmorpholine-4-carbohydrazide |
| SMILES | CC1(C)CN(C(=O)NN)CC(C)(C)O1 |
| InChI | InChI=1S/C9H19N3O2/c1-8(2)5-12(7(13)11-10)6-9(3,4)14-8/h5-6,10H2,1-4H3,(H,11,13) |
| InChIKey | KZOVRICFUHEOAU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|