C13H23F3N2O3 — CID 100658017
2,2,6,6-tetramethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboxamide (PubChem CID 100658017) has the molecular formula C13H23F3N2O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboxamide.
| Compound Name | 2,2,6,6-tetramethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 100658017 |
| Molecular Formula | C13H23F3N2O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboxamide |
| SMILES | CC1(C)CN(C(=O)NCCOCC(F)(F)F)CC(C)(C)O1 |
| InChI | InChI=1S/C13H23F3N2O3/c1-11(2)7-18(8-12(3,4)21-11)10(19)17-5-6-20-9-13(14,15)16/h5-9H2,1-4H3,(H,17,19) |
| InChIKey | RTMFJLZEIXWEBW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|