C15H28N2O4 — CID 102744984
2-methyl-5-[(2,2,6,6-tetramethylmorpholine-4-carbonyl)amino]pentanoic acid (PubChem CID 102744984) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-methyl-5-[(2,2,6,6-tetramethylmorpholine-4-carbonyl)amino]pentanoic acid.
| Compound Name | 2-methyl-5-[(2,2,6,6-tetramethylmorpholine-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 102744984 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2-methyl-5-[(2,2,6,6-tetramethylmorpholine-4-carbonyl)amino]pentanoic acid |
| SMILES | CC(CCCNC(=O)N1CC(C)(C)OC(C)(C)C1)C(=O)O |
| InChI | InChI=1S/C15H28N2O4/c1-11(12(18)19)7-6-8-16-13(20)17-9-14(2,3)21-15(4,5)10-17/h11H,6-10H2,1-5H3,(H,16,20)(H,18,19) |
| InChIKey | KADBEVUSLGELHV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|