C13H21F3N2O4 — CID 122021975
4-[[2,2,6-trimethyl-6-(trifluoromethyl)morpholine-4-carbonyl]amino]butanoic acid (PubChem CID 122021975) has the molecular formula C13H21F3N2O4 and a molecular weight of 326.32 g/mol. Its IUPAC name is 4-[[2,2,6-trimethyl-6-(trifluoromethyl)morpholine-4-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[2,2,6-trimethyl-6-(trifluoromethyl)morpholine-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122021975 |
| Molecular Formula | C13H21F3N2O4 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-[[2,2,6-trimethyl-6-(trifluoromethyl)morpholine-4-carbonyl]amino]butanoic acid |
| SMILES | CC1(C)CN(C(=O)NCCCC(=O)O)CC(C)(C(F)(F)F)O1 |
| InChI | InChI=1S/C13H21F3N2O4/c1-11(2)7-18(8-12(3,22-11)13(14,15)16)10(21)17-6-4-5-9(19)20/h4-8H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | QKBCHHALPVUUDM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|