4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid

C11H20N2O4 — CID 61187052

IUPAC4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid
SMILESCC1CN(C(=O)NCCCC(=O)O)CC(C)O1
InChIInChI=1S/C11H20N2O4/c1-8-6-13(7-9(2)17-8)11(16)12-5-3-4-10(14)15/h8-9H,3-7H2,1-2H3,(H,12,16)(H,14,15)
InChIKeyFVIXZXALIQGESB-UHFFFAOYSA-N
MW244.29 g/mol
LogP0.67
Rot. Bonds4

About 4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid

4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid (PubChem CID 61187052) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid.

Molecular Properties

Compound Name4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid
PubChem CID61187052
Molecular FormulaC11H20N2O4
Molecular Weight244.29 g/mol
Exact Mass244.14
IUPAC Name4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid
SMILESCC1CN(C(=O)NCCCC(=O)O)CC(C)O1
InChIInChI=1S/C11H20N2O4/c1-8-6-13(7-9(2)17-8)11(16)12-5-3-4-10(14)15/h8-9H,3-7H2,1-2H3,(H,12,16)(H,14,15)
InChIKeyFVIXZXALIQGESB-UHFFFAOYSA-N
XLogP0.67
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.29
LogP ≤ 50.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid?
The IUPAC name of 4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid (CID 61187052) is 4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid.
What is the SMILES notation for 4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid?
The canonical SMILES for 4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid is CC1CN(C(=O)NCCCC(=O)O)CC(C)O1.
What is the InChIKey of 4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid?
The InChIKey is FVIXZXALIQGESB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O4/c1-8-6-13(7-9(2)17-8)11(16)12-5-3-4-10(14)15/h8-9H,3-7H2,1-2H3,(H,12,16)(H,14,15).
What are the key properties of 4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid?
4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid has a molecular weight of 244.29 g/mol, XLogP of 0.67, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dimethylmorpholine-4-carbonyl)amino]butanoic acid is sourced from PubChem (CID 61187052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).