C14H29N3O4S — CID 94031550
(2R,6S)-2,6-dimethyl-N-[3-[methylsulfonyl(propan-2-yl)amino]propyl]morpholine-4-carboxamide (PubChem CID 94031550) has the molecular formula C14H29N3O4S and a molecular weight of 335.47 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-N-[3-[methylsulfonyl(propan-2-yl)amino]propyl]morpholine-4-carboxamide.
| Compound Name | (2R,6S)-2,6-dimethyl-N-[3-[methylsulfonyl(propan-2-yl)amino]propyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 94031550 |
| Molecular Formula | C14H29N3O4S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-N-[3-[methylsulfonyl(propan-2-yl)amino]propyl]morpholine-4-carboxamide |
| SMILES | CC(C)N(CCCNC(=O)N1C[C@@H](C)O[C@@H](C)C1)S(C)(=O)=O |
| InChI | InChI=1S/C14H29N3O4S/c1-11(2)17(22(5,19)20)8-6-7-15-14(18)16-9-12(3)21-13(4)10-16/h11-13H,6-10H2,1-5H3,(H,15,18)/t12-,13+ |
| InChIKey | XUIAODSLNFQXMM-BETUJISGSA-N |
| XLogP | 0.87 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|