About N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide
N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide (PubChem CID 56540877) has the molecular formula C19H37N3O5S
and a molecular weight of 419.59 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide.
Molecular Properties
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide |
| PubChem CID | 56540877 |
| Molecular Formula | C19H37N3O5S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NCCS(=O)(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C19H37N3O5S/c1-5-11-21(12-6-2)19(24)9-7-8-18(23)20-10-13-28(25,26)22-14-16(3)27-17(4)15-22/h16-17H,5-15H2,1-4H3,(H,20,23) |
| InChIKey | NDDGBHAXHFPYPG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide?
The IUPAC name of N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide (CID 56540877) is N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide.
What is the SMILES notation for N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide?
The canonical SMILES for N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide is CCCN(CCC)C(=O)CCCC(=O)NCCS(=O)(=O)N1CC(C)OC(C)C1.
What is the InChIKey of N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide?
The InChIKey is NDDGBHAXHFPYPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37N3O5S/c1-5-11-21(12-6-2)19(24)9-7-8-18(23)20-10-13-28(25,26)22-14-16(3)27-17(4)15-22/h16-17H,5-15H2,1-4H3,(H,20,23).
What are the key properties of N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide?
N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide has a molecular weight of 419.59 g/mol, XLogP of 1.36, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-N',N'-dipropylpentanediamide is sourced from PubChem (CID 56540877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).