About tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate
tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate (PubChem CID 47082029) has the molecular formula C15H29N3O6S
and a molecular weight of 379.48 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate |
| PubChem CID | 47082029 |
| Molecular Formula | C15H29N3O6S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate |
| SMILES | CC1CN(S(=O)(=O)CCNC(=O)CNC(=O)OC(C)(C)C)CC(C)O1 |
| InChI | InChI=1S/C15H29N3O6S/c1-11-9-18(10-12(2)23-11)25(21,22)7-6-16-13(19)8-17-14(20)24-15(3,4)5/h11-12H,6-10H2,1-5H3,(H,16,19)(H,17,20) |
| InChIKey | LBVWDCWUGWCGOY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate (CID 47082029) is tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate is CC1CN(S(=O)(=O)CCNC(=O)CNC(=O)OC(C)(C)C)CC(C)O1.
What is the InChIKey of tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate?
The InChIKey is LBVWDCWUGWCGOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O6S/c1-11-9-18(10-12(2)23-11)25(21,22)7-6-16-13(19)8-17-14(20)24-15(3,4)5/h11-12H,6-10H2,1-5H3,(H,16,19)(H,17,20).
What are the key properties of tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate?
tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate has a molecular weight of 379.48 g/mol, XLogP of 0.07, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]-2-oxoethyl]carbamate is sourced from PubChem (CID 47082029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).