C13H28N2O3S — CID 95177772
N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2,2-dimethylpropan-1-amine (PubChem CID 95177772) has the molecular formula C13H28N2O3S and a molecular weight of 292.44 g/mol. Its IUPAC name is N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2,2-dimethylpropan-1-amine.
| Compound Name | N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 95177772 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylethyl]-2,2-dimethylpropan-1-amine |
| SMILES | C[C@@H]1CN(S(=O)(=O)CCNCC(C)(C)C)C[C@H](C)O1 |
| InChI | InChI=1S/C13H28N2O3S/c1-11-8-15(9-12(2)18-11)19(16,17)7-6-14-10-13(3,4)5/h11-12,14H,6-10H2,1-5H3/t11-,12+ |
| InChIKey | MEYQPHBTFKEDOU-TXEJJXNPSA-N |
| XLogP | 1.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|