C14H24N2O5S — CID 56807009
[5-[[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]methyl]furan-2-yl]methanol (PubChem CID 56807009) has the molecular formula C14H24N2O5S and a molecular weight of 332.42 g/mol. Its IUPAC name is [5-[[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]methyl]furan-2-yl]methanol.
| Compound Name | [5-[[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 56807009 |
| Molecular Formula | C14H24N2O5S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [5-[[2-(2,6-dimethylmorpholin-4-yl)sulfonylethylamino]methyl]furan-2-yl]methanol |
| SMILES | CC1CN(S(=O)(=O)CCNCc2ccc(CO)o2)CC(C)O1 |
| InChI | InChI=1S/C14H24N2O5S/c1-11-8-16(9-12(2)20-11)22(18,19)6-5-15-7-13-3-4-14(10-17)21-13/h3-4,11-12,15,17H,5-10H2,1-2H3 |
| InChIKey | AECHNXASKNPIMK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|