C15H22ClN3O5S — CID 55824776
N-[(4-chloro-3-nitrophenyl)methyl]-2-(2,6-dimethylmorpholin-4-yl)sulfonylethanamine (PubChem CID 55824776) has the molecular formula C15H22ClN3O5S and a molecular weight of 391.88 g/mol. Its IUPAC name is N-[(4-chloro-3-nitrophenyl)methyl]-2-(2,6-dimethylmorpholin-4-yl)sulfonylethanamine.
| Compound Name | N-[(4-chloro-3-nitrophenyl)methyl]-2-(2,6-dimethylmorpholin-4-yl)sulfonylethanamine |
|---|---|
| PubChem CID | 55824776 |
| Molecular Formula | C15H22ClN3O5S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[(4-chloro-3-nitrophenyl)methyl]-2-(2,6-dimethylmorpholin-4-yl)sulfonylethanamine |
| SMILES | CC1CN(S(=O)(=O)CCNCc2ccc(Cl)c([N+](=O)[O-])c2)CC(C)O1 |
| InChI | InChI=1S/C15H22ClN3O5S/c1-11-9-18(10-12(2)24-11)25(22,23)6-5-17-8-13-3-4-14(16)15(7-13)19(20)21/h3-4,7,11-12,17H,5-6,8-10H2,1-2H3 |
| InChIKey | QVJYKYXJFWDBGY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|