C15H23N3O7S2 — CID 47085793
N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-4-methylsulfonyl-3-nitroaniline (PubChem CID 47085793) has the molecular formula C15H23N3O7S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-4-methylsulfonyl-3-nitroaniline.
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-4-methylsulfonyl-3-nitroaniline |
|---|---|
| PubChem CID | 47085793 |
| Molecular Formula | C15H23N3O7S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-4-methylsulfonyl-3-nitroaniline |
| SMILES | CC1CN(S(=O)(=O)CCNc2ccc(S(C)(=O)=O)c([N+](=O)[O-])c2)CC(C)O1 |
| InChI | InChI=1S/C15H23N3O7S2/c1-11-9-17(10-12(2)25-11)27(23,24)7-6-16-13-4-5-15(26(3,21)22)14(8-13)18(19)20/h4-5,8,11-12,16H,6-7,9-10H2,1-3H3 |
| InChIKey | SOPMWZQQVLEGNJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|