C21H31N5O7S — CID 55658089
4-(4-acetylpiperazin-1-yl)-N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-nitrobenzamide (PubChem CID 55658089) has the molecular formula C21H31N5O7S and a molecular weight of 497.57 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-nitrobenzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55658089 |
| Molecular Formula | C21H31N5O7S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-nitrobenzamide |
| SMILES | CC(=O)N1CCN(c2ccc(C(=O)NCCS(=O)(=O)N3CC(C)OC(C)C3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H31N5O7S/c1-15-13-25(14-16(2)33-15)34(31,32)11-6-22-21(28)18-4-5-19(20(12-18)26(29)30)24-9-7-23(8-10-24)17(3)27/h4-5,12,15-16H,6-11,13-14H2,1-3H3,(H,22,28) |
| InChIKey | GIOIKEOCMQBNAI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 142.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|