C26H34N6O4 — CID 55638705
4-(4-acetylpiperazin-1-yl)-3-nitro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide (PubChem CID 55638705) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-3-nitro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-3-nitro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 55638705 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-3-nitro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
| SMILES | CC(=O)N1CCN(c2ccc(C(=O)NCCCN3CCN(c4ccccc4)CC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C26H34N6O4/c1-21(33)29-16-18-31(19-17-29)24-9-8-22(20-25(24)32(35)36)26(34)27-10-5-11-28-12-14-30(15-13-28)23-6-3-2-4-7-23/h2-4,6-9,20H,5,10-19H2,1H3,(H,27,34) |
| InChIKey | GJVLABNNIVVNHM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|