C18H28ClN5O3 — CID 119391857
3-nitro-N-(3-piperazin-1-ylpropyl)-4-pyrrolidin-1-ylbenzamide;hydrochloride (PubChem CID 119391857) has the molecular formula C18H28ClN5O3 and a molecular weight of 397.91 g/mol. Its IUPAC name is 3-nitro-N-(3-piperazin-1-ylpropyl)-4-pyrrolidin-1-ylbenzamide;hydrochloride.
| Compound Name | 3-nitro-N-(3-piperazin-1-ylpropyl)-4-pyrrolidin-1-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119391857 |
| Molecular Formula | C18H28ClN5O3 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 3-nitro-N-(3-piperazin-1-ylpropyl)-4-pyrrolidin-1-ylbenzamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCNCC1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H27N5O3.ClH/c24-18(20-6-3-9-21-12-7-19-8-13-21)15-4-5-16(17(14-15)23(25)26)22-10-1-2-11-22;/h4-5,14,19H,1-3,6-13H2,(H,20,24);1H |
| InChIKey | LOXRFSCCGPKWJN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|