C17H22N4O4 — CID 110838730
N-(3-nitro-4-pyrrolidin-1-ylbenzoyl)piperidine-4-carboxamide (PubChem CID 110838730) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(3-nitro-4-pyrrolidin-1-ylbenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(3-nitro-4-pyrrolidin-1-ylbenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110838730 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(3-nitro-4-pyrrolidin-1-ylbenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(NC(=O)C1CCNCC1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H22N4O4/c22-16(12-5-7-18-8-6-12)19-17(23)13-3-4-14(15(11-13)21(24)25)20-9-1-2-10-20/h3-4,11-12,18H,1-2,5-10H2,(H,19,22,23) |
| InChIKey | PUQVYCQKTHNUTP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|