C22H23ClN6O5S — CID 17314208
N-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 17314208) has the molecular formula C22H23ClN6O5S and a molecular weight of 518.98 g/mol. Its IUPAC name is N-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17314208 |
| Molecular Formula | C22H23ClN6O5S |
| Molecular Weight | 518.98 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | N-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NC(=S)N1CCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H23ClN6O5S/c23-16-4-6-18(20(14-16)29(33)34)26-9-11-27(12-10-26)22(35)24-21(30)15-3-5-17(19(13-15)28(31)32)25-7-1-2-8-25/h3-6,13-14H,1-2,7-12H2,(H,24,30,35) |
| InChIKey | VBVISUXYKLTSFZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.98 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|