C24H28N6O6S — CID 17314124
N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 17314124) has the molecular formula C24H28N6O6S and a molecular weight of 528.59 g/mol. Its IUPAC name is N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17314124 |
| Molecular Formula | C24H28N6O6S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | COc1ccc(N2CCN(C(=S)NC(=O)c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H28N6O6S/c1-36-18-6-8-20(22(16-18)30(34)35)27-11-13-28(14-12-27)24(37)25-23(31)17-5-7-19(21(15-17)29(32)33)26-9-3-2-4-10-26/h5-8,15-16H,2-4,9-14H2,1H3,(H,25,31,37) |
| InChIKey | RXSFSLRRVHSVLE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|