C23H21N5O7S — CID 5043053
N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 5043053) has the molecular formula C23H21N5O7S and a molecular weight of 511.52 g/mol. Its IUPAC name is N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 5043053 |
| Molecular Formula | C23H21N5O7S |
| Molecular Weight | 511.52 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | N-[4-(4-methoxy-2-nitrophenyl)piperazine-1-carbothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=S)NC(=O)c3ccc(-c4cccc([N+](=O)[O-])c4)o3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21N5O7S/c1-34-17-5-6-18(19(14-17)28(32)33)25-9-11-26(12-10-25)23(36)24-22(29)21-8-7-20(35-21)15-3-2-4-16(13-15)27(30)31/h2-8,13-14H,9-12H2,1H3,(H,24,29,36) |
| InChIKey | KGARJHUZUDQTRX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|