C26H27ClN4O5 — CID 17050477
N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 17050477) has the molecular formula C26H27ClN4O5 and a molecular weight of 510.98 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17050477 |
| Molecular Formula | C26H27ClN4O5 |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCN(c2ccc(NC(=O)c3ccc(-c4cccc([N+](=O)[O-])c4)o3)cc2Cl)CC1 |
| InChI | InChI=1S/C26H27ClN4O5/c1-26(2,3)25(33)30-13-11-29(12-14-30)21-8-7-18(16-20(21)27)28-24(32)23-10-9-22(36-23)17-5-4-6-19(15-17)31(34)35/h4-10,15-16H,11-14H2,1-3H3,(H,28,32) |
| InChIKey | UHFDAWHDRDRVJL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|