C23H21ClN4O5 — CID 17111809
N-[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 17111809) has the molecular formula C23H21ClN4O5 and a molecular weight of 468.90 g/mol. Its IUPAC name is N-[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17111809 |
| Molecular Formula | C23H21ClN4O5 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | N-[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=O)c3ccc(-c4cccc([N+](=O)[O-])c4)o3)cc2Cl)CC1 |
| InChI | InChI=1S/C23H21ClN4O5/c1-15(29)26-9-11-27(12-10-26)20-6-5-17(14-19(20)24)25-23(30)22-8-7-21(33-22)16-3-2-4-18(13-16)28(31)32/h2-8,13-14H,9-12H2,1H3,(H,25,30) |
| InChIKey | JWRMIRAPZRQGIP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|