C30H25ClN4O5 — CID 43913566
N-[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 43913566) has the molecular formula C30H25ClN4O5 and a molecular weight of 557.01 g/mol. Its IUPAC name is N-[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 43913566 |
| Molecular Formula | C30H25ClN4O5 |
| Molecular Weight | 557.01 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | N-[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)/C=C/c3ccccc3)CC2)c(Cl)c1)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C30H25ClN4O5/c31-25-20-23(32-30(37)28-13-12-27(40-28)22-7-4-8-24(19-22)35(38)39)10-11-26(25)33-15-17-34(18-16-33)29(36)14-9-21-5-2-1-3-6-21/h1-14,19-20H,15-18H2,(H,32,37)/b14-9+ |
| InChIKey | KYJNNDWTQBOZNG-NTEUORMPSA-N |
| XLogP | 6.12 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.01 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|