C30H26N4O5 — CID 17358253
5-(2-nitrophenyl)-N-[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]furan-2-carboxamide (PubChem CID 17358253) has the molecular formula C30H26N4O5 and a molecular weight of 522.56 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-N-[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | 5-(2-nitrophenyl)-N-[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17358253 |
| Molecular Formula | C30H26N4O5 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 5-(2-nitrophenyl)-N-[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)/C=C/c3ccccc3)CC2)cc1)c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C30H26N4O5/c35-29(17-10-22-6-2-1-3-7-22)33-20-18-32(19-21-33)24-13-11-23(12-14-24)31-30(36)28-16-15-27(39-28)25-8-4-5-9-26(25)34(37)38/h1-17H,18-21H2,(H,31,36)/b17-10+ |
| InChIKey | WBQIJCHYFUNUBK-LICLKQGHSA-N |
| XLogP | 5.47 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|