C27H29N5O5S — CID 17334534
N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 17334534) has the molecular formula C27H29N5O5S and a molecular weight of 535.63 g/mol. Its IUPAC name is N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17334534 |
| Molecular Formula | C27H29N5O5S |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3ccc(-c4ccccc4[N+](=O)[O-])o3)cc2)CC1 |
| InChI | InChI=1S/C27H29N5O5S/c1-18(2)17-25(33)31-15-13-30(14-16-31)20-9-7-19(8-10-20)28-27(38)29-26(34)24-12-11-23(37-24)21-5-3-4-6-22(21)32(35)36/h3-12,18H,13-17H2,1-2H3,(H2,28,29,34,38) |
| InChIKey | CSLHBJIOPDVTQL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|