C23H23N5O6S2 — CID 17318331
N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 17318331) has the molecular formula C23H23N5O6S2 and a molecular weight of 529.60 g/mol. Its IUPAC name is N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17318331 |
| Molecular Formula | C23H23N5O6S2 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3ccc(-c4ccccc4[N+](=O)[O-])o3)cc2)CC1 |
| InChI | InChI=1S/C23H23N5O6S2/c1-36(32,33)27-14-12-26(13-15-27)17-8-6-16(7-9-17)24-23(35)25-22(29)21-11-10-20(34-21)18-4-2-3-5-19(18)28(30)31/h2-11H,12-15H2,1H3,(H2,24,25,29,35) |
| InChIKey | NZVVATVQZQJWAL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 138.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|