C28H23ClN4O4S — CID 17358633
3-chloro-7-nitro-N-[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 17358633) has the molecular formula C28H23ClN4O4S and a molecular weight of 547.04 g/mol. Its IUPAC name is 3-chloro-7-nitro-N-[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-7-nitro-N-[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17358633 |
| Molecular Formula | C28H23ClN4O4S |
| Molecular Weight | 547.04 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 3-chloro-7-nitro-N-[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)/C=C/c3ccccc3)CC2)cc1)c1sc2c([N+](=O)[O-])cccc2c1Cl |
| InChI | InChI=1S/C28H23ClN4O4S/c29-25-22-7-4-8-23(33(36)37)26(22)38-27(25)28(35)30-20-10-12-21(13-11-20)31-15-17-32(18-16-31)24(34)14-9-19-5-2-1-3-6-19/h1-14H,15-18H2,(H,30,35)/b14-9+ |
| InChIKey | WOBVUSOKAALKRW-NTEUORMPSA-N |
| XLogP | 6.08 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.04 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|