C20H18ClN3O3S — CID 1302365
3-chloro-7-nitro-N-(2-piperidin-1-ylphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 1302365) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is 3-chloro-7-nitro-N-(2-piperidin-1-ylphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-7-nitro-N-(2-piperidin-1-ylphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 1302365 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 3-chloro-7-nitro-N-(2-piperidin-1-ylphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCCCC1)c1sc2c([N+](=O)[O-])cccc2c1Cl |
| InChI | InChI=1S/C20H18ClN3O3S/c21-17-13-7-6-10-16(24(26)27)18(13)28-19(17)20(25)22-14-8-2-3-9-15(14)23-11-4-1-5-12-23/h2-3,6-10H,1,4-5,11-12H2,(H,22,25) |
| InChIKey | AWAHILOSSRQOQD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|