C27H23ClN4O4S — CID 17099133
3-chloro-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-7-nitro-1-benzothiophene-2-carboxamide (PubChem CID 17099133) has the molecular formula C27H23ClN4O4S and a molecular weight of 535.03 g/mol. Its IUPAC name is 3-chloro-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-7-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-7-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17099133 |
| Molecular Formula | C27H23ClN4O4S |
| Molecular Weight | 535.03 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 3-chloro-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-7-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCN(c3ccc(NC(=O)c4sc5c([N+](=O)[O-])cccc5c4Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H23ClN4O4S/c1-17-5-7-18(8-6-17)27(34)31-15-13-30(14-16-31)20-11-9-19(10-12-20)29-26(33)25-23(28)21-3-2-4-22(32(35)36)24(21)37-25/h2-12H,13-16H2,1H3,(H,29,33) |
| InChIKey | JTWOKAHCDWFWAX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.03 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|