C18H13ClN2O5S — CID 9204312
ethyl 4-[(3-chloro-7-nitro-1-benzothiophene-2-carbonyl)amino]benzoate (PubChem CID 9204312) has the molecular formula C18H13ClN2O5S and a molecular weight of 404.83 g/mol. Its IUPAC name is ethyl 4-[(3-chloro-7-nitro-1-benzothiophene-2-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(3-chloro-7-nitro-1-benzothiophene-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 9204312 |
| Molecular Formula | C18H13ClN2O5S |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | ethyl 4-[(3-chloro-7-nitro-1-benzothiophene-2-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2sc3c([N+](=O)[O-])cccc3c2Cl)cc1 |
| InChI | InChI=1S/C18H13ClN2O5S/c1-2-26-18(23)10-6-8-11(9-7-10)20-17(22)16-14(19)12-4-3-5-13(21(24)25)15(12)27-16/h3-9H,2H2,1H3,(H,20,22) |
| InChIKey | ZQEKCWJIWOTBCV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|