C17H11ClN2O5S — CID 28669368
4-[[(3-chloro-7-nitro-1-benzothiophene-2-carbonyl)amino]methyl]benzoic acid (PubChem CID 28669368) has the molecular formula C17H11ClN2O5S and a molecular weight of 390.80 g/mol. Its IUPAC name is 4-[[(3-chloro-7-nitro-1-benzothiophene-2-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(3-chloro-7-nitro-1-benzothiophene-2-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 28669368 |
| Molecular Formula | C17H11ClN2O5S |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 4-[[(3-chloro-7-nitro-1-benzothiophene-2-carbonyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2sc3c([N+](=O)[O-])cccc3c2Cl)cc1 |
| InChI | InChI=1S/C17H11ClN2O5S/c18-13-11-2-1-3-12(20(24)25)14(11)26-15(13)16(21)19-8-9-4-6-10(7-5-9)17(22)23/h1-7H,8H2,(H,19,21)(H,22,23) |
| InChIKey | DPUZIXCCQUTHTO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|