C26H22ClN5O3S — CID 17335646
N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-3-chloro-7-nitro-1-benzothiophene-2-carboxamide (PubChem CID 17335646) has the molecular formula C26H22ClN5O3S and a molecular weight of 520.01 g/mol. Its IUPAC name is N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-3-chloro-7-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-3-chloro-7-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17335646 |
| Molecular Formula | C26H22ClN5O3S |
| Molecular Weight | 520.01 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-3-chloro-7-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CCCCc1ccc(-n2nc3cc(C)c(NC(=O)c4sc5c([N+](=O)[O-])cccc5c4Cl)cc3n2)cc1 |
| InChI | InChI=1S/C26H22ClN5O3S/c1-3-4-6-16-9-11-17(12-10-16)31-29-20-13-15(2)19(14-21(20)30-31)28-26(33)25-23(27)18-7-5-8-22(32(34)35)24(18)36-25/h5,7-14H,3-4,6H2,1-2H3,(H,28,33) |
| InChIKey | SIRFJWKCBXFJCI-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.01 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|