C26H28N4O — CID 2067619
N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-2,4-dimethylbenzamide (PubChem CID 2067619) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-2,4-dimethylbenzamide.
| Compound Name | N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 2067619 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-2,4-dimethylbenzamide |
| SMILES | CCCCc1ccc(-n2nc3cc(C)c(NC(=O)c4ccc(C)cc4C)cc3n2)cc1 |
| InChI | InChI=1S/C26H28N4O/c1-5-6-7-20-9-11-21(12-10-20)30-28-24-15-19(4)23(16-25(24)29-30)27-26(31)22-13-8-17(2)14-18(22)3/h8-16H,5-7H2,1-4H3,(H,27,31) |
| InChIKey | BZLWIZSJPWDYRU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |