C30H26Cl2N4O2 — CID 17318968
(E)-N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17318968) has the molecular formula C30H26Cl2N4O2 and a molecular weight of 545.47 g/mol. Its IUPAC name is (E)-N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17318968 |
| Molecular Formula | C30H26Cl2N4O2 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | (E)-N-[2-(4-butylphenyl)-6-methylbenzotriazol-5-yl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CCCCc1ccc(-n2nc3cc(C)c(NC(=O)/C=C/c4ccc(-c5cc(Cl)cc(Cl)c5)o4)cc3n2)cc1 |
| InChI | InChI=1S/C30H26Cl2N4O2/c1-3-4-5-20-6-8-24(9-7-20)36-34-27-14-19(2)26(18-28(27)35-36)33-30(37)13-11-25-10-12-29(38-25)21-15-22(31)17-23(32)16-21/h6-18H,3-5H2,1-2H3,(H,33,37)/b13-11+ |
| InChIKey | ZCTPZDMALRTTRG-ACCUITESSA-N |
| XLogP | 8.29 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|